Impurity B of Calcitriol 10mg
Impurity B of Calcitriol, Calcitriol is the hormonally active form of vitamin D, Calcitriol is the active metabolite of vitamin D3 that activates the vitamin D receptor (VDR).
| Trivial name | Impurity B of Calcitriol 10mg |
| Catalog Number | A15123-10 |
| Alternative Name(s) | (1R, 3R, 5Z)-5-[(2E)-2-[(1R, 3aS, 7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2, 3, 3a, 5, 6, 7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1, 3-diol |
| Molecular Formula | C27H44O3 |
| CAS# | 66791-71-7 |
| SMILES | CC(CCCC(C)(C)O)C1CCC2C1(CCCC2=CC=C3CC(CC(C3=C)O)O)C |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/impurity-b-of-calcitriol.html |
