H-1152 dihydrochloride 10mg
H-1152 dihydrochloride, an isoquinolinesulfonamide derivative, is a more specific, stronger and membrane-permeable inhibitor of Rho-kinase with a Ki value of 1.6 nM, but poor inhibitor of other serine/threonine kinases.
| Trivial name | H-1152 dihydrochloride 10mg |
| Catalog Number | A15102-10 |
| Alternative Name(s) | 4-methyl-5-[(2-methyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline;dihydrochloride |
| Molecular Formula | C16H23Cl2N3O2S |
| CAS# | 871543-07-6 |
| SMILES | CC1CNCCCN1S(=O)(=O)C2=CC=CC3=CN=CC(=C32)C.Cl.Cl |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/h-1152-dihydrochloride.html |