H-1152 50mg
H-1152, an isoquinolinesulfonamide derivative, is a more specific, stronger and membrane-permeable inhibitor of Rho-kinase with a Ki value of 1.6 nM, but poor inhibitor of other serine/threonine kinases.
| Trivial name | H-1152 50mg |
| Catalog Number | A15101-50 |
| Alternative Name(s) | 4-methyl-5-[[(2R)-2-methyl-1,4-diazepan-1-yl]sulfonyl]isoquinoline;dihydrochloride |
| Molecular Formula | C16H21N3O2S |
| CAS# | 451462-58-1 |
| SMILES | CC1CNCCCN1S(=O)(=O)C2=CC=CC3=CN=CC(=C32)C |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/h-1152.html |
