EVP-6124 hydrochloride 10mg
EVP-6124 hydrochloride is a novel partial agonist of ??7 neuronal nicotinic acetylcholine receptors (nAChRs). EVP-6124 showed selectivity for ??7 nAChRs and did not activate or inhibit heteromeric ??4??2 nAChRs.
| Trivial name | EVP-6124 hydrochloride 10mg |
| Catalog Number | A15087-10 |
| Alternative Name(s) | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-7-chloro-1-benzothiophene-2-carboxamide;hydrochloride |
| Molecular Formula | C16H18Cl2N2OS |
| CAS# | 550999-74-1 |
| SMILES | C1CN2CCC1C(C2)NC(=O)C3=CC4=C(S3)C(=CC=C4)Cl.Cl |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/evp-6124-hydrochloride.html |