E-3810 5mg
E-3810 is a potent and selective dual inhibitor of VEGF and FGF receptors with IC50 values of 7 nM, 25 nM, 10 nM, 17.5 nM and 82.5 nM for VEGFR-1, VEGFR-2, VEGFR-3, FGFR-1 and FGFR-2, respectively.
| Trivial name | E-3810 5mg |
| Catalog Number | A15073-5 |
| Alternative Name(s) | 6-[7-[(1-aminocyclopropyl)methoxy]-6-methoxyquinolin-4-yl]oxy-N-methylnaphthalene-1-carboxamide |
| Molecular Formula | C26H25N3O4 |
| CAS# | 1058137-23-7 |
| SMILES | CNC(=O)C1=CC=CC2=C1C=CC(=C2)OC3=C4C=C(C(=CC4=NC=C3)OCC5(CC5)N)OC |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/e-3810.html |
