Deferasirox Fe3+ chelate 50mg
Deferasirox Fe3+ chelate is a rationally-designed oral iron chelator; its main use is to reduce chronic iron overload in patients who are receiving long-term blood transfusions for conditions such as beta-thalassemia and other chronic anemias.
| Trivial name | Deferasirox Fe3+ chelate 50mg |
| Catalog Number | A15063-50 |
| Alternative Name(s) | 4-[3,5-bis(2-oxidophenyl)-1,2,4-triazol-1-yl]benzoate;iron(3+) |
| Molecular Formula | C21H12FeN3O4 |
| CAS# | 554435-83-5 |
| SMILES | C1=CC=C(C(=C1)C2=NN(C(=N2)C3=CC=CC=C3[O-])C4=CC=C(C=C4)C(=O)[O-])[O-].[Fe+3] |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/deferasirox-fe3-chelate.html |
