CX-6258 hydrochloride hydrate 5mg
CX-6258 hydrochloride hydrate is a potent, orally efficacious Pim 1/2/3 kinase(IC50=5 nM/25 nM/16 nM) inhibitor with excellent biochemical potency and kinase selectivity.
| Trivial name | CX-6258 hydrochloride hydrate 5mg |
| Catalog Number | A15055-5 |
| Alternative Name(s) | (3E)-5-Chloro-3-[[5-[3-[(hexahydro-4-methyl-1H-1,4-diazepin-1-yl)carbonyl]phenyl]-2-furanyl]methylene]-1,3-dihydro-2H-indol-2-one hydrochloride hydrate (1:1:1) |
| Molecular Formula | C26H27Cl2N3O4 |
| CAS# | 1353858-99-7 |
| SMILES | CN1CCCN(CC1)C(=O)C2=CC=CC(=C2)C3=CC=C(O3)C=C4C5=C(C=CC(=C5)Cl)NC4=O.O.Cl |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/cx-6258-hydrochloride-hydrate.html |
