c-Met inhibitor 1 5mg
c-Met inhibitor 1 is an inhibitor of the c-Met receptor signaling pathway useful for the treatment of cancer including gastric, glioblastoma, and pancreatic cancer.
| Trivial name | c-Met inhibitor 1 5mg |
| Catalog Number | A15049-5 |
| Alternative Name(s) | 3-(2-methylindazol-5-yl)sulfanyl-6-(1-methylpyrazol-4-yl)-[1,2,4]triazolo[4,3-b]pyridazine |
| Molecular Formula | C17H14N8S |
| CAS# | 1357072-61-7 |
| SMILES | CN1C=C(C=N1)C2=NN3C(=NN=C3SC4=CC5=CN(N=C5C=C4)C)C=C2 |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/c-met-inhibitor-1.html |