CID-2858522 10mg
CID-2858522 selectively inhibits the NF-??B pathway (IC50 < 0.1 ??M for PMA-stimulated IL-8 production) induced by PKC, operating downstream of PKC but upstream of IKKbeta, without inhibiting other NF-kappaB activation pathways.
| Trivial name | CID-2858522 10mg |
| Catalog Number | A15046-10 |
| Alternative Name(s) | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[2-(3-hydroxypropylamino)-5,6-dimethylbenzimidazol-1-yl]ethanone |
| Molecular Formula | C28H39N3O3 |
| CAS# | 758679-97-9 |
| SMILES | CC1=CC2=C(C=C1C)N(C(=N2)NCCCO)CC(=O)C3=CC(=C(C(=C3)C(C)(C)C)O)C(C)(C)C |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/cid-2858522.html |