AZD1152 20mg
AZD1152 is a pro-drug that rapidly undergoes phosphatase-mediated cleavage in serum to release barasertib-hQPA, a selective Aurora B kinase inhibitor that has shown preliminary activity in clinical studies of patients with acute myeloid leukemia (AML).
| Trivial name | AZD1152 20mg |
| Catalog Number | A15011-20 |
| Alternative Name(s) | 2-[ethyl-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropyl]amino]ethyl dihydrogen phosphate |
| Molecular Formula | C26H31FN7O6P |
| CAS# | 722543-31-9 |
| SMILES | CCN(CCCOC1=CC2=C(C=C1)C(=NC=N2)NC3=NNC(=C3)CC(=O)NC4=CC(=CC=C4)F)CCOP(=O)(O)O |
| Size | 20mg |
| Supplier Page | http://www.adooq.com/azd1152.html |
