AT7867 dihydrochloride 200mg
AT7867 dihydrochloride is a potent ATP-competitive inhibitor of Akt1/2/3 and p70S6K/PKA with IC50 of 32 nM/17 nM/47 nM and 85 nM/20 nM, respectively, little activity outside the AGC kinase family.
| Trivial name | AT7867 dihydrochloride 200mg |
| Catalog Number | A15006-200 |
| Alternative Name(s) | 4-(4-chlorophenyl)-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine,dihydrochloride |
| Molecular Formula | C20H22Cl3N3 |
| CAS# | 1431697-86-7 |
| SMILES | C1CNCCC1(C2=CC=C(C=C2)C3=CNN=C3)C4=CC=C(C=C4)Cl.Cl.Cl |
| Size | 200mg |
| Supplier Page | http://www.adooq.com/at7867-dihydrochloride.html |