ARRY-520 R enantiomer 10mg
ARRY-520 R enantiomer is the R form of ARRY-520, which is a synthetic, small molecule kinesin spindle protein (KSP) inhibitor with IC50 of 6 nM.
| Trivial name | ARRY-520 R enantiomer 10mg |
| Catalog Number | A15001-10 |
| Alternative Name(s) | (2R)-2-(3-aminopropyl)-5-(2,5-difluorophenyl)-N-methoxy-N-methyl-2-phenyl-1,3,4-thiadiazole-3-carboxamide |
| Molecular Formula | C20H22F2N4O2S |
| CAS# | 885060-08-2 |
| SMILES | CN(C(=O)N1C(SC(=N1)C2=C(C=CC(=C2)F)F)(CCCN)C3=CC=CC=C3)OC |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/arry-520-r-enantiomer.html |
