A 438079 hydrochloride 10mg
A 438079 Hcl is a competitive P2X7 receptor antagonist (pIC50 = 6.9 for the inhibition of Ca2+ influx in the human recombinant P2X7 cell line).
| Trivial name | A 438079 hydrochloride 10mg |
| Catalog Number | A14983-10 |
| Alternative Name(s) | 3-[[5-(2,3-dichlorophenyl)tetrazol-1-yl]methyl]pyridine;hydrochloride |
| Molecular Formula | C13H10Cl3N5 |
| CAS# | 899431-18-6 |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=NN=NN2CC3=CN=CC=C3.Cl |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/a-438079-hydrochloride.html |