7-Epi 10-Desacetyl Paclitaxel 50mg
7-Epi 10-Desacetyl Paclitaxel is a derivative of Paclitaxel, which is a microtubule polymer stabilizer with IC50 of 0.1 pM in human endothelial cells.
| Trivial name | 7-Epi 10-Desacetyl Paclitaxel 50mg |
| Catalog Number | A14980-50 |
| Alternative Name(s) | 10-Deacetyl-7-epi-paclitaxel |
| Molecular Formula | C45H49NO13 |
| CAS# | 78454-17-8 |
| SMILES | CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)C6=CC=CC=C6)O)O)OC(=O)C7=CC=CC=C7)(CO4)OC(=O)C)O)C)O |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/7-epi-10-desacetyl-paclitaxel.html |
