24, 25-Dihydroxy VD3 1mg
24, 25-Dihydroxy VD3 is a compound which is closely related to 1,25-dihydroxyvitamin D3, the active form of vitamin D3, but like vitamin D3 itself and 25-hydroxyvitamin D3 is inactive as a hormone both in vitro and in vivo.
| Trivial name | 24, 25-Dihydroxy VD3 1mg |
| Catalog Number | A14973-1 |
| Alternative Name(s) | (6R)-6-[(1R,3aS,4E,7aR)-4-[(2Z)-2-[(5S)-5-hydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptane-2,3-diol |
| Molecular Formula | C27H44O3 |
| CAS# | 40013-87-4 |
| SMILES | CC(CCC(C(C)(C)O)O)C1CCC2C1(CCCC2=CC=C3CC(CCC3=C)O)C |
| Size | 1mg |
| Supplier Page | http://www.adooq.com/24-25-dihydroxy-vd3.html |
