Calpain Inhibitor II, ALLM 5mg
Calpain Inhibitor II, ALLM is a cell-permeable inhibitor of calpain I, calpain II, cathepsin L and cathepsin B with Ki values of 120 nM, 230 nM, 0.6 nM and 100 nM, respectively.
| Trivial name | Calpain Inhibitor II, ALLM 5mg |
| Catalog Number | A14911-5 |
| Alternative Name(s) | 2-acetamido-4-methyl-N-[4-methyl-1-[(4-methylsulfanyl-1-oxobutan-2-yl)amino]-1-oxopentan-2-yl]pentanamide |
| Molecular Formula | C19H35N3O4S |
| CAS# | 136632-32-1 |
| SMILES | CC(C)CC(C(=O)NC(CC(C)C)C(=O)NC(CCSC)C=O)NC(=O)C |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/calpain-inhibitor-ii-allm.html |
