Angiotensin III (human, mouse) 250mg
Angiotensin III is a hexapeptide formed as a result of a cleavage at the N-terminus of Angiotensin II, a key factor in the Renin-Angiotensin-Aldosterone (RAAS) system by angiotensinases located in red blood cells and the vascular beds of most tissues.
| Trivial name | Angiotensin III (human, mouse) 250mg |
| Catalog Number | A14864-250 |
| Alternative Name(s) | Arg-Val-Tyr-Ile-His-Pro-Phe |
| Molecular Formula | C46H66N12O9 |
| CAS# | 13602-53-4 |
| SMILES | CCC(C)C(C(=O)NC(CC1=CN=CN1)C(=O)N2CCCC2C(=O)NC(CC3=CC=CC=C3)C(=O)O)NC(=O)C(CC4=CC=C(C=C4)O)NC(=O)C(C(C)C)NC(=O)C(CCCN=C(N)N)N |
| Size | 250mg |
| Supplier Page | http://www.adooq.com/angiotensin-iii-human-mouse.html |