Mollugin 25mg
Mollugin, a bioactive phytochemical isolated from Rubia cordifolia L. (Rubiaceae), exhibits antimutagenic activity, antitumor activity, antiviral activity, and inhibitory activity in arachidonic acid- and collagen-induced platelet aggregation.
| Trivial name | Mollugin 25mg |
| Catalog Number | A14851-25 |
| Alternative Name(s) | Methyl 6-hydroxy-2,2-dimethylbenzo[h]chromene-5-carboxylate |
| Molecular Formula | C17H16O4 |
| CAS# | 55481-88-4 |
| SMILES | CC1(C=CC2=C(O1)C3=CC=CC=C3C(=C2C(=O)OC)O)C |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/mollugin.html |
