Tanshinone IIA sulfonic sodium 50mg
Tanshinone IIA sulfonic sodium is a water-soluble derivative of tanshinone IIA isolated as the major active component from salvia miltiorrhiza, a kind of Chinese herbal medicine.
Trivial name | Tanshinone IIA sulfonic sodium 50mg |
Catalog Number | A14595-50 |
Alternative Name(s) | Phenanthro(1,2-b)furan-2-sulfonic acid, 6,7,8,9,10,11-hexahydro-1,6,6-trimethyl-10,11-dioxo-, sodium salt |
Molecular Formula | C19H17O6SNa |
CAS# | 69659-80-9 |
SMILES | CC1=C(OC2=C1C(=O)C(=O)C3=C2C=CC4=C3CCCC4(C)C)S(=O)(=O)[O-].[Na+] |
Size | 50mg |
Supplier Page | http://www.adooq.com/tanshinone-iia-sulfonic-sodium.html |