Isolinderalactone 25mg
Isolinderalactone inhibits proliferation of A549 human nonsmall cell lung cancer cells by arresting the cell cycle at the G0/G1 phase and inducing a Fas receptor and soluble Fas ligand-mediated apoptotic pathway.
| Trivial name | Isolinderalactone 25mg |
| Catalog Number | A14500-25 |
| Alternative Name(s) | (3aS)-4,8-Dimethyl-3-methylene-4??-ethenyl-3a??,4,5,8b??-tetrahydrobenzo[1,2-b:3,4-b']difuran-2(3H)-one |
| Molecular Formula | C15H16O3 |
| CAS# | 957-66-4 |
| SMILES | O=C(C(C([H])([H])C([H])([H])/C([H])=C(C([H])([H])[H])/C1([H])[H])=C2[H])O[C@@]2([H])C3=C1OC([H])=C3C([H])([H])[H] |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/isolinderalactone.html |
