INCB39110 10mg
INCB39110 is a potent JAK1 tyrosine kinase inhibitor, which is currently in Phase II trials for the treatment of rheumatoid arthritis, myelofibrosis, rheumatoid arthritis and plaque psoriasis.
| Trivial name | INCB39110 10mg |
| Catalog Number | A14390-10 |
| Alternative Name(s) | 2-(3-(4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1H-pyrazol-1-yl)-1-(1-(3-fluoro-2-(trifluoromethyl)isonicotinoyl)piperidin-4-yl)azetidin-3-yl)acetonitrile |
| Molecular Formula | C26H23F4N9O |
| CAS# | 1334298-90-6 |
| SMILES | N#CCC1(N2N=CC(C3=C4C(NC=C4)=NC=N3)=C2)CN(C5CCN(C(C6=C(F)C(C(F)(F)F)=NC=C6)=O)CC5)C1 |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/incb39110.html |
