Oroxylin A 5mg
Oroxylin A is an O-methylated flavone, It has demonstrated activity as a dopamine reuptake inhibitor and is also a negative allosteric modulator of the benzodiazepine site of the GABAA receptor.
| Trivial name | Oroxylin A 5mg |
| Catalog Number | A14367-5 |
| Alternative Name(s) | 5,7-dihydroxy-6-methoxy-2-phenylchromen-4-one |
| Molecular Formula | 5,7-Dihydroxy-6-methoxyflavone |
| CAS# | 480-11-5 |
| SMILES | COC1=C(C=C2C(=C1O)C(=O)C=C(O2)C3=CC=CC=C3)O |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/oroxylin-a.html |