Capromorelin 5mg
Capromorelin functions as a growth hormone secretagogue and ghrelin mimetic which causes the body to secrete human growth hormone in a way usually seen at puberty and in young adulthood.
Trivial name | Capromorelin 5mg |
Catalog Number | A14350-5 |
Alternative Name(s) | N-[(2R)-1-[(3aR)-2-Methyl-3-oxo-3a-(phenylmethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]-1-oxo-3-(phenylmethoxy)propan-2-yl]-2-amino-2-methylpropanamide |
Molecular Formula | C₂₈H₃₅N₅O₄ |
CAS# | 193273-66-4 |
SMILES | CC(C)(C(=O)N[C@H](COCC1=CC=CC=C1)C(=O)N2CCC3=NN(C(=O)[C@@]3(C2)CC4=CC=CC=C4)C)N |
Size | 5mg |
Supplier Page | http://www.adooq.com/capromorelin.html |