IB-MECA 5mg
IB-MECA has been shown to act as a potent and selective Adenosine A3-R agonist with Ki values of 1.1, 54 and 56 nM for Adenosine A3-R, Adenosine A1-R and Adenosine A2A-R, respectively.
| Trivial name | IB-MECA 5mg |
| Catalog Number | A14345-5 |
| Alternative Name(s) | 1-Deoxy-1-[6-[[(3-iodophenyl)methyl]amino]-9H-purin-9-yl]-N-methyl-beta-D-ribofuranuronamide |
| Molecular Formula | C18H19IN6O4 |
| CAS# | 152918-18-8 |
| SMILES | CNC(=O)[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C2N=CN=C3NCC4=CC(=CC=C4)I)O)O |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/ib-meca.html |
