SU9516 10mM * 1mL in DMSO
SU9516 is a potent, selective cdk2 inhibitor. It inhibits pRb phosphorylation causing enhanced pRB/E2F complex formation and induces G1 and G2-M cell cycle arrest.
| Trivial name | SU9516 10mM * 1mL in DMSO |
| Catalog Number | A14318-10mM-D |
| Alternative Name(s) | (Z)-1,3-Dihydro-3-(1H-imidazol-4-ylmethylene)-5-methoxy-2H-indol-2-one |
| Molecular Formula | C13H11N3O2 |
| CAS# | 377090-84-1 |
| SMILES | COC1=CC2=C(C=C1)NC(=O)/C2=CC3=CN=CN3 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/su9516.html |