K02288 10mM * 1mL in DMSO
K02288 is a potent, and selective type I BMP receptor inhibitor with IC50 of 1.1, 1.8, 6.4 nM for ALK2, ALK1 and ALK6.
| Trivial name | K02288 10mM * 1mL in DMSO |
| Catalog Number | A14311-10mM-D |
| Alternative Name(s) | 3-[(6-Amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenol |
| Molecular Formula | C20H20N2O4 |
| CAS# | 1431985-92-0 |
| SMILES | COC1=CC(=CC(=C1OC)OC)C2=C(N=CC(=C2)C3=CC(=CC=C3)O)N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/k02288.html |
