Telotristat Etiprate 10mM * 1mL in DMSO
Telotristat Etiprate (LX 1606 Hippurate) is an orally bioavailable, tryptophan hydroxylase (TPH) inhibitor with potential antiserotonergic activity.
| Trivial name | Telotristat Etiprate 10mM * 1mL in DMSO |
| Catalog Number | A14299-10mM-D |
| Alternative Name(s) | L-Phenylalanine, 4-[2-amino-6-[(1R)-1-[4-chloro-2-(3-methyl-1H-pyrazol-1-yl)phenyl]-2,2,2-trifluoroethoxy]-4-pyrimidinyl]-, ethyl ester, compd. with N-benzoylglycine (1:1) |
| Molecular Formula | C27H26ClF3N6O3.C9H9NO3 |
| CAS# | 11137608-69-5 |
| SMILES | CCOC(=O)[C@H](CC1=CC=C(C=C1)C2=CC(=NC(=N2)N)O[C@H](C3=C(C=C(C=C3)Cl)N4C=CC(=N4)C)C(F)(F)F)N.C1=CC=C(C=C1)C(=O)NCC(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/telotristat-etiprate.html |