KN-93 Phosphate 50mg
KN-93 Phosphate is a potent and specific inhibitor of Ca2+/calmodulin-dependent protein kinase II (CaMKII) with Ki of 0.37 ??M, no remarkable inhibitory effects on APK, PKC, MLCK or Ca2+-PDE activities.
| Trivial name | KN-93 Phosphate 50mg |
| Catalog Number | A14288-50 |
| Alternative Name(s) | Benzenesulfonamide, N-?[2-?[[[(2E)?-?3-?(4-?chlorophenyl)?-?2-?propen-?1-?yl]?methylamino]?methyl]?phenyl]?-?N-?(2-?hydroxyethyl)?-?4-?methoxy-?, phosphate (1:1) |
| Molecular Formula | C26H29ClN2O4S. H3O4P |
| CAS# | 1188890-41-6 |
| SMILES | [HH].CN(C/C=C/C1=CC=C(C=C1)Cl)CC2=CC=CC=C2N(CCO)S(=O)(=O)C3=CC=C(C=C3)OC.OOP(=O)=O |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/kn-93-phosphate.html |