Almorexant HCl 10mM * 1mL in DMSO
Almorexant HCl is an orally active, dual orexin receptor antagonist with IC50 of 6.6 nM and 3.4 nM for OX1 and OX2 receptor 3.
| Trivial name | Almorexant HCl 10mM * 1mL in DMSO |
| Catalog Number | A14286-10mM-D |
| Alternative Name(s) | (R)-2-((S)-1-(4-(trifluoromethyl)phenethyl)-6,7-dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl)-N-methyl-2-phenylacetamide hydrochloride |
| Molecular Formula | C29H32ClF3N2O3 |
| CAS# | 913358-93-7 |
| SMILES | CNC(=O)[C@@H](C1=CC=CC=C1)N2CCC3=CC(=C(C=C3[C@@H]2CCC4=CC=C(C=C4)C(F)(F)F)OC)OC.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/almorexant-hcl.html |