HJC0350 10mM * 1mL in DMSO
HJC0350 is a potent and selective EPAC2 inhibitor with IC50 of 0.3 ??M, exhibiting no inhibition on Epac1.
| Trivial name | HJC0350 10mM * 1mL in DMSO |
| Catalog Number | A14266-10mM-D |
| Alternative Name(s) | 2,4-dimethyl-1-[(2,4,6-trimethylphenyl)sulfonyl]-1H-pyrrole |
| Molecular Formula | C15H19NO2S |
| CAS# | 885434-70-8 |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)N2C=C(C=C2C)C)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/hjc0350.html |
