Bambuterol HCl 10mM * 1mL in DMSO
Bambuterol HCl is a potent ??-adrenoceptor agonist, used in the treatment of asthma.
| Trivial name | Bambuterol HCl 10mM * 1mL in DMSO |
| Catalog Number | A14251-10mM-D |
| Alternative Name(s) | Carbamic acid, N,N-dimethyl-, 3-[[(dimethylamino)carbonyl]oxy]-5-[2-[(1,1-dimethylethyl)amino]-1-hydroxyethyl]phenyl ester, hydrochloride (1:1) |
| Molecular Formula | C18H29N3O5.HCl |
| CAS# | 81732-46-9 |
| SMILES | CC(C)(C)NCC(C1=CC(=CC(=C1)OC(=O)N(C)C)OC(=O)N(C)C)O.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/bambuterol-hcl.html |