SH-4-54 10mM * 1mL in DMSO
SH-4-54 is a potent STAT inhibitor with KD of 300 nM and 464 nM for STAT3 and STAT5.
Trivial name | SH-4-54 10mM * 1mL in DMSO |
Catalog Number | A14249-10mM-D |
Alternative Name(s) | 4-[[(4-cyclohexylphenyl)methyl][2-[methyl[(2,3,4,5,6-pentafluorophenyl)sulfonyl]amino]acetyl]amino]-benzoic acid |
Molecular Formula | C29H27F5N2O5S |
CAS# | 1456632-40-8 |
SMILES | CN(CC(=O)N(CC1=CC=C(C=C1)C2CCCCC2)C3=CC=C(C=C3)C(=O)O)S(=O)(=O)C4=C(C(=C(C(=C4F)F)F)F)F |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/sh-4-54.html |