Diphenidol HCl 10mM * 1mL in DMSO
Diphenidol HCl is a potent antagonist of muscarinic M2 and M3 receptor with pKb of 6.72 and 7.02.
| Trivial name | Diphenidol HCl 10mM * 1mL in DMSO |
| Catalog Number | A14244-10mM-D |
| Alternative Name(s) | ??,??-diphenyl-1-piperidinebutanol,hydrochloride (1:1) |
| Molecular Formula | C21H28ClNO |
| CAS# | 3254-89-5 |
| SMILES | C1CCN(CC1)CCCC(C2=CC=CC=C2)(C3=CC=CC=C3)O.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/diphenidol-hcl.html |