ESI-09 10mM * 1mL in DMSO
ESI-09 is a specific exchange protein directly activated by cAMP (EPAC) inhibitor with IC50 of 3.2 ??M and 1.4 ??M for EPAC1 and EPAC2,
Trivial name | ESI-09 10mM * 1mL in DMSO |
Catalog Number | A14233-10mM-D |
Alternative Name(s) | (E)-3-(5-tert-butylisoxazol-3-yl)-2-(2-(3-chlorophenyl)hydrazono)-3-oxopropanenitrile |
Molecular Formula | C16H15ClN4O2 |
CAS# | 263707-16-0 |
SMILES | CC(C)(C)C1=CC(=NO1)C(=O)/C(=N/NC2=CC(=CC=C2)Cl)/C#N |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/esi-09.html |