UMI-77 10mM * 1mL in DMSO
UMI-77 is a selective Mcl-1 inhibitor with Ki of 490 nM, showing selectivity over other members of Bcl-2 family.
| Trivial name | UMI-77 10mM * 1mL in DMSO |
| Catalog Number | A14222-10mM-D |
| Alternative Name(s) | 2-[[4-[[(4-bromophenyl)sulfonyl]amino]-1-hydroxy-2-naphthalenyl]thio]-acetic acid |
| Molecular Formula | C18H14BrNO5S2 |
| CAS# | 518303-20-3 |
| SMILES | C1=CC=C2C(=C1)C(=CC(=C2O)SCC(=O)O)NS(=O)(=O)C3=CC=C(C=C3)Br |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/umi-77.html |