UMI-77 10mM * 1mL in DMSO
UMI-77 is a selective Mcl-1 inhibitor with Ki of 490 nM, showing selectivity over other members of Bcl-2 family.
Trivial name | UMI-77 10mM * 1mL in DMSO |
Catalog Number | A14222-10mM-D |
Alternative Name(s) | 2-[[4-[[(4-bromophenyl)sulfonyl]amino]-1-hydroxy-2-naphthalenyl]thio]-acetic acid |
Molecular Formula | C₁₈H₁₄BrNO₅S₂ |
CAS# | 518303-20-3 |
SMILES | C1=CC=C2C(=C1)C(=CC(=C2O)SCC(=O)O)NS(=O)(=O)C3=CC=C(C=C3)Br |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/umi-77.html |