Blasticidin S HCl 10mM * 1mL in DMSO
Blasticidin S HCl is a nucleoside antibiotic isolated from Stretomyces girseochromogenes, and acts as a DNA and protein synthesis inhibitor.
Trivial name | Blasticidin S HCl 10mM * 1mL in DMSO |
Catalog Number | A14212-10mM-D |
Alternative Name(s) | (S)-4-[[3-amino-5-[(aminoiminomethyl)methylamino]-1-oxopentyl]amino]-1-(4-amino-2-oxo-1(2H)-pyrimidinyl)-1,2,3,4-tetradeoxy-??-D-erythro-Hex-2-enopyranuronic acid,monohydrochloride |
Molecular Formula | C17H27ClN8O5 |
CAS# | 3513-03-9 |
SMILES | CN(CC[C@H](CC(=O)N[C@H]1C=C[C@@H](O[C@@H]1C(=O)O)N2C=CC(=NC2=O)N)N)C(=N)N.Cl |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/blasticidin-s-hcl.html |