Cerdulatinib 10mM * 1mL in DMSO
Cerdulatinib (PRT-062070) is an oral active, multi-targeted tyrosine kinase inhibitor with IC50 of 12 nM/6 nM/8 nM/0.5 nM and 32 nM for JAK1/JAK2/JAK3/TYK2 and Syk, respectively.
| Trivial name | Cerdulatinib 10mM * 1mL in DMSO |
| Catalog Number | A14210-10mM-D |
| Alternative Name(s) | 4-(cyclopropylamino)-2-[[4-[4-(ethylsulfonyl)-1-piperazinyl]phenyl]amino]-5-pyrimidinecarboxamide,hydrochloride (1:1) |
| Molecular Formula | C20H28ClN7O3S |
| CAS# | 1369761-01-2 |
| SMILES | CCS(=O)(=O)N1CCN(CC1)C2=CC=C(C=C2)NC3=NC=C(C(=N3)NC4CC4)C(=O)N.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/cerdulatinib.html |
