IM-12 10mM * 1mL in DMSO
IM-12 is a cell-permeable indolylmaleimide that acts as a Glycogen synthase kinase 3?? (GSK-3??) inhibitor, activating downstream components of canonical Wnt signaling.
| Trivial name | IM-12 10mM * 1mL in DMSO |
| Catalog Number | A14196-10mM-D |
| Alternative Name(s) | 3-(4-Fluorophenylethylamino)-1-methyl-4-(2-methyl-1H-indol-3-yl)-1H-pyrrole-2,5-dione |
| Molecular Formula | C22H20FN3O2 |
| CAS# | 1129669-05-1 |
| SMILES | CC1=C(C2=CC=CC=C2N1)C3=C(C(=O)N(C3=O)C)NCCC4=CC=C(C=C4)F |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/im-12.html |
