ONX 0912 10mM * 1mL in DMSO
ONX 0912 is a tripeptide epoxyketone, which inhibits growth and induces apoptosis in MM cells resistant to conventional and bortezomib therapies.
| Trivial name | ONX 0912 10mM * 1mL in DMSO |
| Catalog Number | A14181-10mM-D |
| Alternative Name(s) | N-((S)-3-methoxy-1-(((S)-3-methoxy-1-(((S)-1-((R)-2-methyloxiran-2-yl)-1-oxo-3-phenylpropan-2-yl)amino)-1-oxopropan-2-yl)amino)-1-oxopropan-2-yl)-2-methylthiazole-5-carboxamide |
| Molecular Formula | C25H32N4O7S |
| CAS# | 935888-69-0 |
| SMILES | CC1=NC=C(S1)C(=O)N[C@@H](COC)C(=O)N[C@@H](COC)C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)[C@]3(CO3)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/onx-0912.html |
