PRT 062070 25mg
PRT062070 is a novel, oral, dual spleen tyrosine kinase (Syk) and janus kinase (JAK) inhibitor. Cerdulatinib preferentially inhibited JAK1 and JAK3 dependent cytokine mediated signaling and functional responses in various cell types.
| Trivial name | PRT 062070 25mg |
| Catalog Number | A14147-25 |
| Alternative Name(s) | 4-(cyclopropylamino)-2-((4-(4-(ethylsulfonyl)piperazin-1-yl)phenyl)amino)pyrimidine-5-carboxamide |
| Molecular Formula | C20H27N7O3S |
| CAS# | 1198300-79-6 |
| SMILES | CCS(=O)(=O)N1CCN(CC1)C2=CC=C(C=C2)NC3=NC=C(C(=N3)NC4CC4)C(=O)N |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/prt-062070.html |
