GSK1324726A 25mg
GSK1324726A (I-BET726) is a novel, potent, and selective small molecule inhibitor of BET proteins with high affinity to BRD2 (IC50= 41 nM), BRD3 (IC50= 31 nM), and BRD4 (IC50= 22 nM).
| Trivial name | GSK1324726A 25mg |
| Catalog Number | A14133-25 |
| Alternative Name(s) | 4-[(2S,4R)-1-Acetyl-4-[(4-chlorophenyl)amino]-2-methyl-1,2,3,4-tetrahydro-6-quinolinyl]benzoic acid |
| Molecular Formula | C25H23ClN2O3 |
| CAS# | 1300031-52-0 |
| SMILES | CC1CC(C2=C(N1C(=O)C)C=CC(=C2)C3=CC=C(C=C3)C(=O)O)NC4=CC=C(C=C4)Cl |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/gsk1324726a.html |
