Piperlongumine 50mg
Piperlongumine selectively kills cancer cells regardless of p53 status without harming normal cells. It binds to and inihbits proteins known to regulate oxidative stress, in particular, Glutathione S-transferase pi 1 (GSTP1).
Trivial name | Piperlongumine 50mg |
Catalog Number | A14124-50 |
Alternative Name(s) | 5,?6-?dihydro-?1-?[(2E)-?1-?oxo-?3-?(3,?4,?5-?trimethoxyphenyl)-?2-?propen-?1-?yl]-?2(1H)-?pyridinone |
Molecular Formula | C17H19NO5 |
CAS# | 20069-09-4 |
SMILES | COC1=CC(=CC(=C1OC)OC)C=CC(=O)N2CCC=CC2=O |
Size | 50mg |
Supplier Page | http://www.adooq.com/piperlongumine.html |