FR 180204 10mM * 1mL in DMSO
FR 180204 is a novel and selective inhibitor of extracellular signal-regulated kinase (ERK), which may be a potential new therapy for rheumatoid arthritis.
| Trivial name | FR 180204 10mM * 1mL in DMSO |
| Catalog Number | A14119-10mM-D |
| Alternative Name(s) | 5-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)-1H-pyrazolo[3,4-c]pyridazin-3-amine |
| Molecular Formula | C18H13N7 |
| CAS# | 865362-74-9 |
| SMILES | C1=CC=C(C=C1)C2=NN3C=CC=CC3=C2C4=CC5=C(NN=C5N=N4)N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/fr-180204.html |