C75 5mg
C75 is a novel, potent synthetic inhibitor of fatty acid synthase (FAS), which is used as a tool for studying fatty acid synthesis in metabolic disorders and cancer.
| Trivial name | C75 5mg |
| Catalog Number | A14107-5 |
| Alternative Name(s) | 4-Methylene-2-octyl-5-oxotetrahydrofuran-3-carboxylic acid |
| Molecular Formula | C14H22O4 |
| CAS# | 218137-86-1 |
| SMILES | CCCCCCCCC1C(C(=C)C(=O)O1)C(=O)O |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/c75.html |