Sivelestat sodium salt 50mg
Sivelestat sodium salt is a selective leukocyte elastase inhibitor (IC50 = 44 nM) that displays no activity at a range of other proteases. It inhibits NF-??B activation and LTB4-induced neutrophil transmigration in vitro.
| Trivial name | Sivelestat sodium salt 50mg |
| Catalog Number | A14073-50 |
| Alternative Name(s) | N-{2-[({4-[(2,2-Dimethylpropanoyl)oxy]phenyl}sulfonyl)amino]benzoyl}glycine sodium salt |
| Molecular Formula | C20H21N2NaO7S |
| CAS# | 150374-95-1 |
| SMILES | CC(C)(C)C(=O)OC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2C(=O)NCC(=O)[O-].[Na+] |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/sivelestat-sodium-salt.html |
