STF 118804 50mg
STF 118804 is a highly specific NAMPT inhibitor that reduces the viability of most B-ALL cell lines with high potency IC50 values in the low nanomolar range and improves survival in an orthotopic xenotransplant model of high-risk acute lymphoblastic leukemia.
| Trivial name | STF 118804 50mg |
| Catalog Number | A14072-50 |
| Alternative Name(s) | 4-(5-Methyl-4-(tosylmethyl)oxazol-2-yl)-N-(pyridin-3-ylmethyl)benzamide |
| Molecular Formula | C25H23N3O4S |
| CAS# | 894187-61-2 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)CC2=C(OC(=N2)C3=CC=C(C=C3)C(=O)NCC4=CN=CC=C4)C |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/stf-118804.html |
