RVX-208 10mM * 1mL in DMSO
RVX-208 is a potent BET bromodomain inhibitor with IC50 of 0.510 ??M for BD2, about 170-fold selectivity over BD1.
| Trivial name | RVX-208 10mM * 1mL in DMSO |
| Catalog Number | A13956-10mM-D |
| Alternative Name(s) | 4(3H)?-?Quinazolinone, 2-?[4-?(2-?hydroxyethoxy)?-?3,?5-?dimethylphenyl]?-?5,?7-?dimethoxy- |
| Molecular Formula | C20H22N2O5 |
| CAS# | 1044870-39-4 |
| SMILES | CC1=CC(=CC(=C1OCCO)C)C2=NC(=O)C3=C(C=C(C=C3N2)OC)OC |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/rvx-208.html |
