Harpagoside 50mg
Harpagoside is an anti-inflammatory small molecule natural product originally isolated from the Harpagophytum procumbens (Devil??s Claw) root, but can be isolated from other plants such as Crophularia ningpoensis Hemsl (Figwort).
Trivial name | Harpagoside 50mg |
Catalog Number | A13953-50 |
Alternative Name(s) | [(1S)-1,4a,5,6,7,7a??-Hexahydro-4a??,5??-dihydroxy-7-methyl-7??-[[(E)-1-oxo-3-phenyl-2-propenyl]oxy]cyclopenta[c]pyran-1??-yl]??-D-glucopyranoside |
Molecular Formula | C24H30O11 |
CAS# | 19210-12-9 |
SMILES | C[C@@]1(C[C@H]([C@]2([C@@H]1[C@@H](OC=C2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O)OC(=O)/C=C/C4=CC=CC=C4 |
Size | 50mg |
Supplier Page | http://www.adooq.com/harpagoside.html |