Fraxinellone 25mg
Fraxinellone is an insecticidal agent, inhibiting growth of larvae, used in the treatment and protection of crops and produce. Also, a naturally occurring compound used in the treatment of tumors.
| Trivial name | Fraxinellone 25mg |
| Catalog Number | A13918-25 |
| Alternative Name(s) | 1(3H)-Isobenzofuranone, 3-(3-furanyl)-3a,4,5,6-tetrahydro-3a,7-dimethyl-, (3R-cis)- (9CI) |
| Molecular Formula | C14H16O3 |
| CAS# | 28808-62-0 |
| SMILES | CC1=C2C(=O)O[C@H]([C@@]2(CCC1)C)C3=COC=C3 |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/fraxinellone.html |
