Biopterin 50mg
Biopterin is the oxidized form of tetrahydro-L-biopterin (BH4), a nitric oxide synthase (NOS) cofactor. L-Biopterin can be reduced to BH4 via thioredoxin reductase followed by dihydropteridine reductase or reduced glutathione. It is extremely toxic to human melanocytes in culture (IC50 = 0.2 ?M after 48 hrs).
| Trivial name | Biopterin 50mg |
| Catalog Number | A13901-50 |
| Alternative Name(s) | 2-?amino-?6-?[(1R,?2S)-?1,?2-?dihydroxypropyl]-?4(1H)-?pteridinone |
| Molecular Formula | C9H11N5O3 |
| CAS# | 22150-76-1 |
| SMILES | CC(C(C1=CN=C2C(=N1)C(=O)N=C(N2)N)O)O |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/biopterin.html |
